C9H24O5 — CID 175057633
methoxymethane;1-methoxypropan-2-ol;propane-1,1-diol (PubChem CID 175057633) has the molecular formula C9H24O5 and a molecular weight of 212.29 g/mol. Its IUPAC name is methoxymethane;1-methoxypropan-2-ol;propane-1,1-diol.
| Compound Name | methoxymethane;1-methoxypropan-2-ol;propane-1,1-diol |
|---|---|
| PubChem CID | 175057633 |
| Molecular Formula | C9H24O5 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | methoxymethane;1-methoxypropan-2-ol;propane-1,1-diol |
| SMILES | CCC(O)O.COC.COCC(C)O |
| InChI | InChI=1S/C4H10O2.C3H8O2.C2H6O/c1-4(5)3-6-2;1-2-3(4)5;1-3-2/h4-5H,3H2,1-2H3;3-5H,2H2,1H3;1-2H3 |
| InChIKey | GSCIVHRJVROAAB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|