About 1-methoxypropan-2-ol;propane
1-methoxypropan-2-ol;propane (PubChem CID 159966080) has the molecular formula C7H18O2
and a molecular weight of 134.22 g/mol. Its IUPAC name is 1-methoxypropan-2-ol;propane.
Molecular Properties
| Compound Name | 1-methoxypropan-2-ol;propane |
| PubChem CID | 159966080 |
| Molecular Formula | C7H18O2 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.13 |
| IUPAC Name | 1-methoxypropan-2-ol;propane |
| SMILES | CCC.COCC(C)O |
| InChI | InChI=1S/C4H10O2.C3H8/c1-4(5)3-6-2;1-3-2/h4-5H,3H2,1-2H3;3H2,1-2H3 |
| InChIKey | ODYICEMNQPYSBU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxypropan-2-ol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-ol;propane?
The IUPAC name of 1-methoxypropan-2-ol;propane (CID 159966080) is 1-methoxypropan-2-ol;propane.
What is the SMILES notation for 1-methoxypropan-2-ol;propane?
The canonical SMILES for 1-methoxypropan-2-ol;propane is CCC.COCC(C)O.
What is the InChIKey of 1-methoxypropan-2-ol;propane?
The InChIKey is ODYICEMNQPYSBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C3H8/c1-4(5)3-6-2;1-3-2/h4-5H,3H2,1-2H3;3H2,1-2H3.
What are the key properties of 1-methoxypropan-2-ol;propane?
1-methoxypropan-2-ol;propane has a molecular weight of 134.22 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-ol;propane is sourced from PubChem (CID 159966080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).