About 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol
2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol (PubChem CID 172753622) has the molecular formula C12H22N4O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol |
| PubChem CID | 172753622 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol |
| SMILES | CC(C)(C#N)/N=N/C(C)(C)C#N.COCC(C)O |
| InChI | InChI=1S/C8H12N4.C4H10O2/c1-7(2,5-9)11-12-8(3,4)6-10;1-4(5)3-6-2/h1-4H3;4-5H,3H2,1-2H3/b12-11+; |
| InChIKey | KSHZGVNSWPBZIU-CALJPSDSSA-N |
| XLogP | 2.06 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol?
The IUPAC name of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol (CID 172753622) is 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol.
What is the SMILES notation for 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol?
The canonical SMILES for 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol is CC(C)(C#N)/N=N/C(C)(C)C#N.COCC(C)O.
What is the InChIKey of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol?
The InChIKey is KSHZGVNSWPBZIU-CALJPSDSSA-N. The full InChI is InChI=1S/C8H12N4.C4H10O2/c1-7(2,5-9)11-12-8(3,4)6-10;1-4(5)3-6-2/h1-4H3;4-5H,3H2,1-2H3/b12-11+;.
What are the key properties of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol?
2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol has a molecular weight of 254.33 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;1-methoxypropan-2-ol is sourced from PubChem (CID 172753622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).