About acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile
acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile (PubChem CID 160646643) has the molecular formula C10H15N5
and a molecular weight of 205.26 g/mol. Its IUPAC name is acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile.
Molecular Properties
| Compound Name | acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile |
| PubChem CID | 160646643 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile |
| SMILES | CC#N.CC(C)(C#N)/N=N/C(C)(C)C#N |
| InChI | InChI=1S/C8H12N4.C2H3N/c1-7(2,5-9)11-12-8(3,4)6-10;1-2-3/h1-4H3;1H3/b12-11+; |
| InChIKey | RJWDNCDADHLRGJ-CALJPSDSSA-N |
| XLogP | 2.57 |
| TPSA | 96.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile?
The IUPAC name of acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile (CID 160646643) is acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile.
What is the SMILES notation for acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile?
The canonical SMILES for acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile is CC#N.CC(C)(C#N)/N=N/C(C)(C)C#N.
What is the InChIKey of acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile?
The InChIKey is RJWDNCDADHLRGJ-CALJPSDSSA-N. The full InChI is InChI=1S/C8H12N4.C2H3N/c1-7(2,5-9)11-12-8(3,4)6-10;1-2-3/h1-4H3;1H3/b12-11+;.
What are the key properties of acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile?
acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile has a molecular weight of 205.26 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile is sourced from PubChem (CID 160646643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).