About 2-hydroxypropyl tris(2-methoxyethyl) silicate
2-hydroxypropyl tris(2-methoxyethyl) silicate (PubChem CID 123776315) has the molecular formula C12H28O8Si
and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-hydroxypropyl tris(2-methoxyethyl) silicate.
Molecular Properties
| Compound Name | 2-hydroxypropyl tris(2-methoxyethyl) silicate |
| PubChem CID | 123776315 |
| Molecular Formula | C12H28O8Si |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-hydroxypropyl tris(2-methoxyethyl) silicate |
| SMILES | COCCO[Si](OCCOC)(OCCOC)OCC(C)O |
| InChI | InChI=1S/C12H28O8Si/c1-12(13)11-20-21(17-8-5-14-2,18-9-6-15-3)19-10-7-16-4/h12-13H,5-11H2,1-4H3 |
| InChIKey | RAOAGJKJZBGWTG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl tris(2-methoxyethyl) silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl tris(2-methoxyethyl) silicate?
The IUPAC name of 2-hydroxypropyl tris(2-methoxyethyl) silicate (CID 123776315) is 2-hydroxypropyl tris(2-methoxyethyl) silicate.
What is the SMILES notation for 2-hydroxypropyl tris(2-methoxyethyl) silicate?
The canonical SMILES for 2-hydroxypropyl tris(2-methoxyethyl) silicate is COCCO[Si](OCCOC)(OCCOC)OCC(C)O.
What is the InChIKey of 2-hydroxypropyl tris(2-methoxyethyl) silicate?
The InChIKey is RAOAGJKJZBGWTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28O8Si/c1-12(13)11-20-21(17-8-5-14-2,18-9-6-15-3)19-10-7-16-4/h12-13H,5-11H2,1-4H3.
What are the key properties of 2-hydroxypropyl tris(2-methoxyethyl) silicate?
2-hydroxypropyl tris(2-methoxyethyl) silicate has a molecular weight of 328.43 g/mol, XLogP of -0.19, 15 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl tris(2-methoxyethyl) silicate is sourced from PubChem (CID 123776315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).