About bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium
bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium (PubChem CID 161195738) has the molecular formula C10H24O8SiU2
and a molecular weight of 776.44 g/mol. Its IUPAC name is bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium.
Molecular Properties
| Compound Name | bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium |
| PubChem CID | 161195738 |
| Molecular Formula | C10H24O8SiU2 |
| Molecular Weight | 776.44 g/mol |
| Exact Mass | 776.23 |
| IUPAC Name | bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium |
| SMILES | COCCO[Si](OCCO)(OCCO)OCCOC.[U].[U] |
| InChI | InChI=1S/C10H24O8Si.2U/c1-13-7-9-17-19(15-5-3-11,16-6-4-12)18-10-8-14-2;;/h11-12H,3-10H2,1-2H3;; |
| InChIKey | MYUOVCMWJCRIKE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 776.44 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium?
The IUPAC name of bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium (CID 161195738) is bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium.
What is the SMILES notation for bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium?
The canonical SMILES for bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium is COCCO[Si](OCCO)(OCCO)OCCOC.[U].[U].
What is the InChIKey of bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium?
The InChIKey is MYUOVCMWJCRIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24O8Si.2U/c1-13-7-9-17-19(15-5-3-11,16-6-4-12)18-10-8-14-2;;/h11-12H,3-10H2,1-2H3;;.
What are the key properties of bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium?
bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium has a molecular weight of 776.44 g/mol, XLogP of -1.23, 14 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethyl) bis(2-methoxyethyl) silicate;uranium is sourced from PubChem (CID 161195738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).