C9H22O4 — CID 87090145
2-(2-hydroxypropoxy)propan-1-ol;methoxyethane (PubChem CID 87090145) has the molecular formula C9H22O4 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-(2-hydroxypropoxy)propan-1-ol;methoxyethane.
| Compound Name | 2-(2-hydroxypropoxy)propan-1-ol;methoxyethane |
|---|---|
| PubChem CID | 87090145 |
| Molecular Formula | C9H22O4 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2-(2-hydroxypropoxy)propan-1-ol;methoxyethane |
| SMILES | CC(O)COC(C)CO.CCOC |
| InChI | InChI=1S/C6H14O3.C3H8O/c1-5(8)4-9-6(2)3-7;1-3-4-2/h5-8H,3-4H2,1-2H3;3H2,1-2H3 |
| InChIKey | DPJDEAJUTUANMH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |