C14H32O5 — CID 134346005
2-ethoxypropane;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol (PubChem CID 134346005) has the molecular formula C14H32O5 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-ethoxypropane;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol.
| Compound Name | 2-ethoxypropane;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 134346005 |
| Molecular Formula | C14H32O5 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-ethoxypropane;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
| SMILES | CC(O)COC(C)COC(C)CO.CCOC(C)C |
| InChI | InChI=1S/C9H20O4.C5H12O/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-4-6-5(2)3/h7-11H,4-6H2,1-3H3;5H,4H2,1-3H3 |
| InChIKey | PBVHLBFROGTCSK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |