C17H38O5 — CID 87745303
2-butan-2-yloxybutane;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol (PubChem CID 87745303) has the molecular formula C17H38O5 and a molecular weight of 322.49 g/mol. Its IUPAC name is 2-butan-2-yloxybutane;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol.
| Compound Name | 2-butan-2-yloxybutane;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 87745303 |
| Molecular Formula | C17H38O5 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 2-butan-2-yloxybutane;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
| SMILES | CC(O)COC(C)COC(C)CO.CCC(C)OC(C)CC |
| InChI | InChI=1S/C9H20O4.C8H18O/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-5-7(3)9-8(4)6-2/h7-11H,4-6H2,1-3H3;7-8H,5-6H2,1-4H3 |
| InChIKey | OHTGDMKNXOHPFY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |