C12H28O4 — CID 23067081
2-(2-hydroxypropoxy)propan-1-ol;1-propoxypropane (PubChem CID 23067081) has the molecular formula C12H28O4 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-(2-hydroxypropoxy)propan-1-ol;1-propoxypropane.
| Compound Name | 2-(2-hydroxypropoxy)propan-1-ol;1-propoxypropane |
|---|---|
| PubChem CID | 23067081 |
| Molecular Formula | C12H28O4 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 2-(2-hydroxypropoxy)propan-1-ol;1-propoxypropane |
| SMILES | CC(O)COC(C)CO.CCCOCCC |
| InChI | InChI=1S/C6H14O3.C6H14O/c1-5(8)4-9-6(2)3-7;1-3-5-7-6-4-2/h5-8H,3-4H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | DZXCTSZZNHMZML-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|