C16H36O5 — CID 87650391
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;1-propoxybutane (PubChem CID 87650391) has the molecular formula C16H36O5 and a molecular weight of 308.46 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;1-propoxybutane.
| Compound Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;1-propoxybutane |
|---|---|
| PubChem CID | 87650391 |
| Molecular Formula | C16H36O5 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;1-propoxybutane |
| SMILES | CC(O)COC(C)COC(C)CO.CCCCOCCC |
| InChI | InChI=1S/C9H20O4.C7H16O/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-3-5-7-8-6-4-2/h7-11H,4-6H2,1-3H3;3-7H2,1-2H3 |
| InChIKey | SOGMDLCOKUSESJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|