C10H22O4 — CID 87090505
butanal;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 87090505) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is butanal;2-(2-hydroxypropoxy)propan-1-ol.
| Compound Name | butanal;2-(2-hydroxypropoxy)propan-1-ol |
|---|---|
| PubChem CID | 87090505 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | butanal;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | CC(O)COC(C)CO.CCCC=O |
| InChI | InChI=1S/C6H14O3.C4H8O/c1-5(8)4-9-6(2)3-7;1-2-3-4-5/h5-8H,3-4H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | ZKRFEQQJFGLJFL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|