About butanal;2-(2-hydroxypropoxy)propan-1-ol
butanal;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 87090505) has the molecular formula C10H22O4
and a molecular weight of 206.28 g/mol. Its IUPAC name is butanal;2-(2-hydroxypropoxy)propan-1-ol.
Molecular Properties
| Compound Name | butanal;2-(2-hydroxypropoxy)propan-1-ol |
| PubChem CID | 87090505 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | butanal;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | CC(O)COC(C)CO.CCCC=O |
| InChI | InChI=1S/C6H14O3.C4H8O/c1-5(8)4-9-6(2)3-7;1-2-3-4-5/h5-8H,3-4H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | ZKRFEQQJFGLJFL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze butanal;2-(2-hydroxypropoxy)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanal;2-(2-hydroxypropoxy)propan-1-ol?
The IUPAC name of butanal;2-(2-hydroxypropoxy)propan-1-ol (CID 87090505) is butanal;2-(2-hydroxypropoxy)propan-1-ol.
What is the SMILES notation for butanal;2-(2-hydroxypropoxy)propan-1-ol?
The canonical SMILES for butanal;2-(2-hydroxypropoxy)propan-1-ol is CC(O)COC(C)CO.CCCC=O.
What is the InChIKey of butanal;2-(2-hydroxypropoxy)propan-1-ol?
The InChIKey is ZKRFEQQJFGLJFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3.C4H8O/c1-5(8)4-9-6(2)3-7;1-2-3-4-5/h5-8H,3-4H2,1-2H3;4H,2-3H2,1H3.
What are the key properties of butanal;2-(2-hydroxypropoxy)propan-1-ol?
butanal;2-(2-hydroxypropoxy)propan-1-ol has a molecular weight of 206.28 g/mol, XLogP of 0.75, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanal;2-(2-hydroxypropoxy)propan-1-ol is sourced from PubChem (CID 87090505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).