C6H16N2O — CID 141008586
(1R,2R)-1,2-diamino-4-methylpentan-1-ol (PubChem CID 141008586) has the molecular formula C6H16N2O and a molecular weight of 132.21 g/mol. Its IUPAC name is (1R,2R)-1,2-diamino-4-methylpentan-1-ol.
| Compound Name | (1R,2R)-1,2-diamino-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 141008586 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | (1R,2R)-1,2-diamino-4-methylpentan-1-ol |
| SMILES | CC(C)C[C@@H](N)[C@H](N)O |
| InChI | InChI=1S/C6H16N2O/c1-4(2)3-5(7)6(8)9/h4-6,9H,3,7-8H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | GCLLKIVQAFOBBX-PHDIDXHHSA-N |
| XLogP | -0.36 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|