C9H21NO4 — CID 88724279
4-amino-6-methylheptan-3-ol;carbonic acid (PubChem CID 88724279) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-amino-6-methylheptan-3-ol;carbonic acid.
| Compound Name | 4-amino-6-methylheptan-3-ol;carbonic acid |
|---|---|
| PubChem CID | 88724279 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 4-amino-6-methylheptan-3-ol;carbonic acid |
| SMILES | CCC(O)C(N)CC(C)C.O=C(O)O |
| InChI | InChI=1S/C8H19NO.CH2O3/c1-4-8(10)7(9)5-6(2)3;2-1(3)4/h6-8,10H,4-5,9H2,1-3H3;(H2,2,3,4) |
| InChIKey | FFJUQXNSYHSFQL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |