C14H30N2O3 — CID 18610389
(3S,4S,9S)-4,9-diamino-5,8-dihydroxy-3,11-dimethyldodecan-6-one (PubChem CID 18610389) has the molecular formula C14H30N2O3 and a molecular weight of 274.41 g/mol. Its IUPAC name is (3S,4S,9S)-4,9-diamino-5,8-dihydroxy-3,11-dimethyldodecan-6-one.
| Compound Name | (3S,4S,9S)-4,9-diamino-5,8-dihydroxy-3,11-dimethyldodecan-6-one |
|---|---|
| PubChem CID | 18610389 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (3S,4S,9S)-4,9-diamino-5,8-dihydroxy-3,11-dimethyldodecan-6-one |
| SMILES | CC[C@H](C)[C@H](N)C(O)C(=O)CC(O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C14H30N2O3/c1-5-9(4)13(16)14(19)12(18)7-11(17)10(15)6-8(2)3/h8-11,13-14,17,19H,5-7,15-16H2,1-4H3/t9-,10-,11?,13-,14?/m0/s1 |
| InChIKey | GUYZFATXFZULGR-JAJSBXODSA-N |
| XLogP | 0.41 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |