C13H28N2O5 — CID 87203953
(3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid;2-(trimethylazaniumyl)acetate (PubChem CID 87203953) has the molecular formula C13H28N2O5 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid;2-(trimethylazaniumyl)acetate.
| Compound Name | (3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid;2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 87203953 |
| Molecular Formula | C13H28N2O5 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid;2-(trimethylazaniumyl)acetate |
| SMILES | CC(C)C[C@H](N)[C@@H](O)CC(=O)O.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C8H17NO3.C5H11NO2/c1-5(2)3-6(9)7(10)4-8(11)12;1-6(2,3)4-5(7)8/h5-7,10H,3-4,9H2,1-2H3,(H,11,12);4H2,1-3H3/t6-,7-;/m0./s1 |
| InChIKey | ATZWSBHYMJHYLT-LEUCUCNGSA-N |
| XLogP | -1.36 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|