C11H26N2O — CID 10512329
(4S,6R)-4,6-diamino-2,8-dimethylnonan-5-ol (PubChem CID 10512329) has the molecular formula C11H26N2O and a molecular weight of 202.34 g/mol. Its IUPAC name is (4S,6R)-4,6-diamino-2,8-dimethylnonan-5-ol.
| Compound Name | (4S,6R)-4,6-diamino-2,8-dimethylnonan-5-ol |
|---|---|
| PubChem CID | 10512329 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | (4S,6R)-4,6-diamino-2,8-dimethylnonan-5-ol |
| SMILES | CC(C)C[C@@H](N)C(O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C11H26N2O/c1-7(2)5-9(12)11(14)10(13)6-8(3)4/h7-11,14H,5-6,12-13H2,1-4H3/t9-,10+,11? |
| InChIKey | UNEGIFTZIAHDHW-ZACCUICWSA-N |
| XLogP | 1.09 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |