C9H21NO2 — CID 137347836
(2R,3S,4S)-4-amino-2,6-dimethylheptane-1,3-diol (PubChem CID 137347836) has the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. Its IUPAC name is (2R,3S,4S)-4-amino-2,6-dimethylheptane-1,3-diol.
| Compound Name | (2R,3S,4S)-4-amino-2,6-dimethylheptane-1,3-diol |
|---|---|
| PubChem CID | 137347836 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | (2R,3S,4S)-4-amino-2,6-dimethylheptane-1,3-diol |
| SMILES | CC(C)C[C@H](N)[C@@H](O)[C@H](C)CO |
| InChI | InChI=1S/C9H21NO2/c1-6(2)4-8(10)9(12)7(3)5-11/h6-9,11-12H,4-5,10H2,1-3H3/t7-,8+,9+/m1/s1 |
| InChIKey | GUNDRKRTYHTHOS-VGMNWLOBSA-N |
| XLogP | 0.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |