C8H18O4 — CID 57029601
2-methylheptane-1,3,4,6-tetrol (PubChem CID 57029601) has the molecular formula C8H18O4 and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-methylheptane-1,3,4,6-tetrol.
| Compound Name | 2-methylheptane-1,3,4,6-tetrol |
|---|---|
| PubChem CID | 57029601 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-methylheptane-1,3,4,6-tetrol |
| SMILES | CC(O)CC(O)C(O)C(C)CO |
| InChI | InChI=1S/C8H18O4/c1-5(4-9)8(12)7(11)3-6(2)10/h5-12H,3-4H2,1-2H3 |
| InChIKey | CAENVGPZFMORDQ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |