C11H24O4 — CID 162900215
(2R,3R,4S,7R,8S)-2,7-dimethylnonane-1,3,4,8-tetrol (PubChem CID 162900215) has the molecular formula C11H24O4 and a molecular weight of 220.31 g/mol. Its IUPAC name is (2R,3R,4S,7R,8S)-2,7-dimethylnonane-1,3,4,8-tetrol.
| Compound Name | (2R,3R,4S,7R,8S)-2,7-dimethylnonane-1,3,4,8-tetrol |
|---|---|
| PubChem CID | 162900215 |
| Molecular Formula | C11H24O4 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | (2R,3R,4S,7R,8S)-2,7-dimethylnonane-1,3,4,8-tetrol |
| SMILES | C[C@H](O)[C@H](C)CC[C@H](O)[C@H](O)[C@H](C)CO |
| InChI | InChI=1S/C11H24O4/c1-7(9(3)13)4-5-10(14)11(15)8(2)6-12/h7-15H,4-6H2,1-3H3/t7-,8-,9+,10+,11-/m1/s1 |
| InChIKey | ZGFJGRZPUGTTQY-SAVGLBRCSA-N |
| XLogP | 0.13 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |