C11H25NO2S — CID 22844602
(4S)-4-amino-6-methyl-1-propan-2-ylsulfanylheptane-2,3-diol (PubChem CID 22844602) has the molecular formula C11H25NO2S and a molecular weight of 235.39 g/mol. Its IUPAC name is (4S)-4-amino-6-methyl-1-propan-2-ylsulfanylheptane-2,3-diol.
| Compound Name | (4S)-4-amino-6-methyl-1-propan-2-ylsulfanylheptane-2,3-diol |
|---|---|
| PubChem CID | 22844602 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (4S)-4-amino-6-methyl-1-propan-2-ylsulfanylheptane-2,3-diol |
| SMILES | CC(C)C[C@H](N)C(O)C(O)CSC(C)C |
| InChI | InChI=1S/C11H25NO2S/c1-7(2)5-9(12)11(14)10(13)6-15-8(3)4/h7-11,13-14H,5-6,12H2,1-4H3/t9-,10?,11?/m0/s1 |
| InChIKey | JXFUNWXJDLOMFH-WHXUTIOJSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |