C6H13F2N — CID 130038441
(2S)-1,1-difluoro-4-methylpentan-2-amine (PubChem CID 130038441) has the molecular formula C6H13F2N and a molecular weight of 137.17 g/mol. Its IUPAC name is (2S)-1,1-difluoro-4-methylpentan-2-amine.
| Compound Name | (2S)-1,1-difluoro-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 130038441 |
| Molecular Formula | C6H13F2N |
| Molecular Weight | 137.17 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (2S)-1,1-difluoro-4-methylpentan-2-amine |
| SMILES | CC(C)C[C@H](N)C(F)F |
| InChI | InChI=1S/C6H13F2N/c1-4(2)3-5(9)6(7)8/h4-6H,3,9H2,1-2H3/t5-/m0/s1 |
| InChIKey | IVKWUHURIPNNIS-YFKPBYRVSA-N |
| XLogP | 1.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |