C13H28O4 — CID 106992842
1-(1-methoxypropan-2-yloxy)-7-methyloctane-2,5-diol (PubChem CID 106992842) has the molecular formula C13H28O4 and a molecular weight of 248.36 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yloxy)-7-methyloctane-2,5-diol.
| Compound Name | 1-(1-methoxypropan-2-yloxy)-7-methyloctane-2,5-diol |
|---|---|
| PubChem CID | 106992842 |
| Molecular Formula | C13H28O4 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-(1-methoxypropan-2-yloxy)-7-methyloctane-2,5-diol |
| SMILES | COCC(C)OCC(O)CCC(O)CC(C)C |
| InChI | InChI=1S/C13H28O4/c1-10(2)7-12(14)5-6-13(15)9-17-11(3)8-16-4/h10-15H,5-9H2,1-4H3 |
| InChIKey | HIMUNELIRABSLM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |