C13H29NO5 — CID 106991830
1-[bis(2-methoxyethyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106991830) has the molecular formula C13H29NO5 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-[bis(2-methoxyethyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-[bis(2-methoxyethyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106991830 |
| Molecular Formula | C13H29NO5 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-[bis(2-methoxyethyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COCCN(CCOC)CC(O)COC(C)COC |
| InChI | InChI=1S/C13H29NO5/c1-12(10-18-4)19-11-13(15)9-14(5-7-16-2)6-8-17-3/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | AGOBPJYQBWLGGL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |