C11H25NO4 — CID 106991846
1-[2-methoxyethyl(methyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106991846) has the molecular formula C11H25NO4 and a molecular weight of 235.32 g/mol. Its IUPAC name is 1-[2-methoxyethyl(methyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-[2-methoxyethyl(methyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106991846 |
| Molecular Formula | C11H25NO4 |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 1-[2-methoxyethyl(methyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COCCN(C)CC(O)COC(C)COC |
| InChI | InChI=1S/C11H25NO4/c1-10(8-15-4)16-9-11(13)7-12(2)5-6-14-3/h10-11,13H,5-9H2,1-4H3 |
| InChIKey | QTYFZSYPTBPDHZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |