C13H29NO3 — CID 106991752
1-(1-methoxypropan-2-yloxy)-3-[methyl(3-methylbutan-2-yl)amino]propan-2-ol (PubChem CID 106991752) has the molecular formula C13H29NO3 and a molecular weight of 247.38 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yloxy)-3-[methyl(3-methylbutan-2-yl)amino]propan-2-ol.
| Compound Name | 1-(1-methoxypropan-2-yloxy)-3-[methyl(3-methylbutan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 106991752 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | 1-(1-methoxypropan-2-yloxy)-3-[methyl(3-methylbutan-2-yl)amino]propan-2-ol |
| SMILES | COCC(C)OCC(O)CN(C)C(C)C(C)C |
| InChI | InChI=1S/C13H29NO3/c1-10(2)12(4)14(5)7-13(15)9-17-11(3)8-16-6/h10-13,15H,7-9H2,1-6H3 |
| InChIKey | MQPDYVVLOXHSSO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |