C10H23NO3 — CID 106991712
1-[ethyl(methyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106991712) has the molecular formula C10H23NO3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-[ethyl(methyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-[ethyl(methyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106991712 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 1-[ethyl(methyl)amino]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | CCN(C)CC(O)COC(C)COC |
| InChI | InChI=1S/C10H23NO3/c1-5-11(3)6-10(12)8-14-9(2)7-13-4/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | XMXNGIJZMOSJBL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |