About 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane
1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane (PubChem CID 134479916) has the molecular formula C13H28O4
and a molecular weight of 248.36 g/mol. Its IUPAC name is 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane.
Molecular Properties
| Compound Name | 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane |
| PubChem CID | 134479916 |
| Molecular Formula | C13H28O4 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane |
| SMILES | COCC(COC)CC(COC)COC(C)C |
| InChI | InChI=1S/C13H28O4/c1-11(2)17-10-13(9-16-5)6-12(7-14-3)8-15-4/h11-13H,6-10H2,1-5H3 |
| InChIKey | JXCOCSLISORNSX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane?
The IUPAC name of 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane (CID 134479916) is 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane.
What is the SMILES notation for 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane?
The canonical SMILES for 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane is COCC(COC)CC(COC)COC(C)C.
What is the InChIKey of 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane?
The InChIKey is JXCOCSLISORNSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O4/c1-11(2)17-10-13(9-16-5)6-12(7-14-3)8-15-4/h11-13H,6-10H2,1-5H3.
What are the key properties of 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane?
1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane has a molecular weight of 248.36 g/mol, XLogP of 1.97, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2,4-bis(methoxymethyl)-5-propan-2-yloxypentane is sourced from PubChem (CID 134479916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).