C14H30O6 — CID 123753623
1,2,3,4,5-pentamethoxy-6-propan-2-yloxyhexane (PubChem CID 123753623) has the molecular formula C14H30O6 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethoxy-6-propan-2-yloxyhexane.
| Compound Name | 1,2,3,4,5-pentamethoxy-6-propan-2-yloxyhexane |
|---|---|
| PubChem CID | 123753623 |
| Molecular Formula | C14H30O6 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 1,2,3,4,5-pentamethoxy-6-propan-2-yloxyhexane |
| SMILES | COCC(OC)C(OC)C(OC)C(COC(C)C)OC |
| InChI | InChI=1S/C14H30O6/c1-10(2)20-9-12(17-5)14(19-7)13(18-6)11(16-4)8-15-3/h10-14H,8-9H2,1-7H3 |
| InChIKey | GUSCVSMGOBNZRB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |