C10H22O5 — CID 90327969
(2R,4R)-1,2,3,4,5-pentamethoxypentane (PubChem CID 90327969) has the molecular formula C10H22O5 and a molecular weight of 222.28 g/mol. Its IUPAC name is (2R,4R)-1,2,3,4,5-pentamethoxypentane.
| Compound Name | (2R,4R)-1,2,3,4,5-pentamethoxypentane |
|---|---|
| PubChem CID | 90327969 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (2R,4R)-1,2,3,4,5-pentamethoxypentane |
| SMILES | COC[C@@H](OC)C(OC)[C@@H](COC)OC |
| InChI | InChI=1S/C10H22O5/c1-11-6-8(13-3)10(15-5)9(14-4)7-12-2/h8-10H,6-7H2,1-5H3/t8-,9-/m1/s1 |
| InChIKey | UKACKIRJWDAFEZ-RKDXNWHRSA-N |
| XLogP | 0.32 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |