C9H18O7 — CID 25209635
(2R,3S,4S,5R)-2,4-dihydroxy-3,5,6-trimethoxyhexanoic acid (PubChem CID 25209635) has the molecular formula C9H18O7 and a molecular weight of 238.24 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,4-dihydroxy-3,5,6-trimethoxyhexanoic acid.
| Compound Name | (2R,3S,4S,5R)-2,4-dihydroxy-3,5,6-trimethoxyhexanoic acid |
|---|---|
| PubChem CID | 25209635 |
| Molecular Formula | C9H18O7 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2R,3S,4S,5R)-2,4-dihydroxy-3,5,6-trimethoxyhexanoic acid |
| SMILES | COC[C@@H](OC)[C@H](O)[C@H](OC)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C9H18O7/c1-14-4-5(15-2)6(10)8(16-3)7(11)9(12)13/h5-8,10-11H,4H2,1-3H3,(H,12,13)/t5-,6+,7-,8+/m1/s1 |
| InChIKey | KLKYXVGAIOVZIR-CWKFCGSDSA-N |
| XLogP | -1.53 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |