C11H24O6 — CID 15689262
(2R,3R,4S,5S)-1,2,4,5,6-pentamethoxyhexan-3-ol (PubChem CID 15689262) has the molecular formula C11H24O6 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2R,3R,4S,5S)-1,2,4,5,6-pentamethoxyhexan-3-ol.
| Compound Name | (2R,3R,4S,5S)-1,2,4,5,6-pentamethoxyhexan-3-ol |
|---|---|
| PubChem CID | 15689262 |
| Molecular Formula | C11H24O6 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2R,3R,4S,5S)-1,2,4,5,6-pentamethoxyhexan-3-ol |
| SMILES | COC[C@H](OC)[C@@H](OC)[C@H](O)[C@@H](COC)OC |
| InChI | InChI=1S/C11H24O6/c1-13-6-8(15-3)10(12)11(17-5)9(16-4)7-14-2/h8-12H,6-7H2,1-5H3/t8-,9+,10-,11-/m1/s1 |
| InChIKey | UJXOUZJWWKZQGR-LMLFDSFASA-N |
| XLogP | -0.31 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |