C11H24O5 — CID 529418
1,2,3,4,5-pentamethoxyhexane (PubChem CID 529418) has the molecular formula C11H24O5 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethoxyhexane.
| Compound Name | 1,2,3,4,5-pentamethoxyhexane |
|---|---|
| PubChem CID | 529418 |
| Molecular Formula | C11H24O5 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1,2,3,4,5-pentamethoxyhexane |
| SMILES | COCC(OC)C(OC)C(OC)C(C)OC |
| InChI | InChI=1S/C11H24O5/c1-8(13-3)10(15-5)11(16-6)9(14-4)7-12-2/h8-11H,7H2,1-6H3 |
| InChIKey | BYHPANAHLMUKFI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |