C8H18O3 — CID 167509153
(3S)-1,2,3-trimethoxypentane (PubChem CID 167509153) has the molecular formula C8H18O3 and a molecular weight of 162.23 g/mol. Its IUPAC name is (3S)-1,2,3-trimethoxypentane.
| Compound Name | (3S)-1,2,3-trimethoxypentane |
|---|---|
| PubChem CID | 167509153 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (3S)-1,2,3-trimethoxypentane |
| SMILES | CC[C@H](OC)C(COC)OC |
| InChI | InChI=1S/C8H18O3/c1-5-7(10-3)8(11-4)6-9-2/h7-8H,5-6H2,1-4H3/t7-,8?/m0/s1 |
| InChIKey | HURIHJCELQOCMD-JAMMHHFISA-N |
| XLogP | 1.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |