C10H23NO2 — CID 116715297
1,5-dimethoxy-3-methylheptan-4-amine (PubChem CID 116715297) has the molecular formula C10H23NO2 and a molecular weight of 189.30 g/mol. Its IUPAC name is 1,5-dimethoxy-3-methylheptan-4-amine.
| Compound Name | 1,5-dimethoxy-3-methylheptan-4-amine |
|---|---|
| PubChem CID | 116715297 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 1,5-dimethoxy-3-methylheptan-4-amine |
| SMILES | CCC(OC)C(N)C(C)CCOC |
| InChI | InChI=1S/C10H23NO2/c1-5-9(13-4)10(11)8(2)6-7-12-3/h8-10H,5-7,11H2,1-4H3 |
| InChIKey | LYLABPXPPDHRIG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |