C11H25NO2 — CID 116718705
1,5-dimethoxy-3-methyloctan-4-amine (PubChem CID 116718705) has the molecular formula C11H25NO2 and a molecular weight of 203.33 g/mol. Its IUPAC name is 1,5-dimethoxy-3-methyloctan-4-amine.
| Compound Name | 1,5-dimethoxy-3-methyloctan-4-amine |
|---|---|
| PubChem CID | 116718705 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | 1,5-dimethoxy-3-methyloctan-4-amine |
| SMILES | CCCC(OC)C(N)C(C)CCOC |
| InChI | InChI=1S/C11H25NO2/c1-5-6-10(14-4)11(12)9(2)7-8-13-3/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | ICODVJJMHDFVJD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |