C11H25NO — CID 105044592
1-methoxy-3,6-dimethyloctan-4-amine (PubChem CID 105044592) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is 1-methoxy-3,6-dimethyloctan-4-amine.
| Compound Name | 1-methoxy-3,6-dimethyloctan-4-amine |
|---|---|
| PubChem CID | 105044592 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 1-methoxy-3,6-dimethyloctan-4-amine |
| SMILES | CCC(C)CC(N)C(C)CCOC |
| InChI | InChI=1S/C11H25NO/c1-5-9(2)8-11(12)10(3)6-7-13-4/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | MVWYIIKOXAAETL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |