C12H27NO2 — CID 116718993
1,5-dimethoxy-N,3-dimethyloctan-4-amine (PubChem CID 116718993) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 1,5-dimethoxy-N,3-dimethyloctan-4-amine.
| Compound Name | 1,5-dimethoxy-N,3-dimethyloctan-4-amine |
|---|---|
| PubChem CID | 116718993 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1,5-dimethoxy-N,3-dimethyloctan-4-amine |
| SMILES | CCCC(OC)C(NC)C(C)CCOC |
| InChI | InChI=1S/C12H27NO2/c1-6-7-11(15-5)12(13-3)10(2)8-9-14-4/h10-13H,6-9H2,1-5H3 |
| InChIKey | CXPVFBOIRGKGOL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |