C6H15NO2 — CID 174961293
1,3-dimethoxy-N-methylpropan-1-amine (PubChem CID 174961293) has the molecular formula C6H15NO2 and a molecular weight of 133.19 g/mol. Its IUPAC name is 1,3-dimethoxy-N-methylpropan-1-amine.
| Compound Name | 1,3-dimethoxy-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 174961293 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 1,3-dimethoxy-N-methylpropan-1-amine |
| SMILES | CNC(CCOC)OC |
| InChI | InChI=1S/C6H15NO2/c1-7-6(9-3)4-5-8-2/h6-7H,4-5H2,1-3H3 |
| InChIKey | ZFGHQUSVKTVLRK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|