C8H17F2NO — CID 103517156
1,1-difluoro-5-methoxy-N,3-dimethylpentan-2-amine (PubChem CID 103517156) has the molecular formula C8H17F2NO and a molecular weight of 181.23 g/mol. Its IUPAC name is 1,1-difluoro-5-methoxy-N,3-dimethylpentan-2-amine.
| Compound Name | 1,1-difluoro-5-methoxy-N,3-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 103517156 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1,1-difluoro-5-methoxy-N,3-dimethylpentan-2-amine |
| SMILES | CNC(C(F)F)C(C)CCOC |
| InChI | InChI=1S/C8H17F2NO/c1-6(4-5-12-3)7(11-2)8(9)10/h6-8,11H,4-5H2,1-3H3 |
| InChIKey | SVOYGCABUSIRCW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |