C10H21NO — CID 116660673
7-methoxy-N,5-dimethylhept-1-en-4-amine (PubChem CID 116660673) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is 7-methoxy-N,5-dimethylhept-1-en-4-amine.
| Compound Name | 7-methoxy-N,5-dimethylhept-1-en-4-amine |
|---|---|
| PubChem CID | 116660673 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 7-methoxy-N,5-dimethylhept-1-en-4-amine |
| SMILES | C=CCC(NC)C(C)CCOC |
| InChI | InChI=1S/C10H21NO/c1-5-6-10(11-3)9(2)7-8-12-4/h5,9-11H,1,6-8H2,2-4H3 |
| InChIKey | NYEMUBLFTYDMRH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|