C12H27NO2 — CID 116720146
1,5-dimethoxy-N,3,6-trimethylheptan-4-amine (PubChem CID 116720146) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 1,5-dimethoxy-N,3,6-trimethylheptan-4-amine.
| Compound Name | 1,5-dimethoxy-N,3,6-trimethylheptan-4-amine |
|---|---|
| PubChem CID | 116720146 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1,5-dimethoxy-N,3,6-trimethylheptan-4-amine |
| SMILES | CNC(C(C)CCOC)C(OC)C(C)C |
| InChI | InChI=1S/C12H27NO2/c1-9(2)12(15-6)11(13-4)10(3)7-8-14-5/h9-13H,7-8H2,1-6H3 |
| InChIKey | KDEKKUNXENYEIN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |