C12H27NO — CID 116720118
5-ethyl-3-methoxy-N,2-dimethylheptan-4-amine (PubChem CID 116720118) has the molecular formula C12H27NO and a molecular weight of 201.35 g/mol. Its IUPAC name is 5-ethyl-3-methoxy-N,2-dimethylheptan-4-amine.
| Compound Name | 5-ethyl-3-methoxy-N,2-dimethylheptan-4-amine |
|---|---|
| PubChem CID | 116720118 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | 5-ethyl-3-methoxy-N,2-dimethylheptan-4-amine |
| SMILES | CCC(CC)C(NC)C(OC)C(C)C |
| InChI | InChI=1S/C12H27NO/c1-7-10(8-2)11(13-5)12(14-6)9(3)4/h9-13H,7-8H2,1-6H3 |
| InChIKey | DTDFRPWRTPTWPR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |