C9H18LrNO- — CID 18339631
N-ethyl-2,4,5-trimethyloxolan-3-amine;lawrencium (PubChem CID 18339631) has the molecular formula C9H18LrNO- and a molecular weight of 418.25 g/mol. Its IUPAC name is N-ethyl-2,4,5-trimethyloxolan-3-amine;lawrencium.
| Compound Name | N-ethyl-2,4,5-trimethyloxolan-3-amine;lawrencium |
|---|---|
| PubChem CID | 18339631 |
| Molecular Formula | C9H18LrNO- |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | N-ethyl-2,4,5-trimethyloxolan-3-amine;lawrencium |
| SMILES | C[CH-]NC1C(C)OC(C)C1C.[Lr] |
| InChI | InChI=1S/C9H18NO.Lr/c1-5-10-9-6(2)7(3)11-8(9)4;/h5-10H,1-4H3;/q-1; |
| InChIKey | MEGVELDWOSGAKS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|