C13H26F3NO — CID 116721673
5-ethoxy-1,1,1-trifluoro-6-methyl-N-propylheptan-4-amine (PubChem CID 116721673) has the molecular formula C13H26F3NO and a molecular weight of 269.35 g/mol. Its IUPAC name is 5-ethoxy-1,1,1-trifluoro-6-methyl-N-propylheptan-4-amine.
| Compound Name | 5-ethoxy-1,1,1-trifluoro-6-methyl-N-propylheptan-4-amine |
|---|---|
| PubChem CID | 116721673 |
| Molecular Formula | C13H26F3NO |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 5-ethoxy-1,1,1-trifluoro-6-methyl-N-propylheptan-4-amine |
| SMILES | CCCNC(CCC(F)(F)F)C(OCC)C(C)C |
| InChI | InChI=1S/C13H26F3NO/c1-5-9-17-11(7-8-13(14,15)16)12(10(3)4)18-6-2/h10-12,17H,5-9H2,1-4H3 |
| InChIKey | SZJSRLWTUXACCG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |