C8H19NO — CID 13140129
1-methoxy-N,4-dimethylpentan-2-amine (PubChem CID 13140129) has the molecular formula C8H19NO and a molecular weight of 145.25 g/mol. Its IUPAC name is 1-methoxy-N,4-dimethylpentan-2-amine.
| Compound Name | 1-methoxy-N,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 13140129 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 1-methoxy-N,4-dimethylpentan-2-amine |
| SMILES | CNC(COC)CC(C)C |
| InChI | InChI=1S/C8H19NO/c1-7(2)5-8(9-3)6-10-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | WUGUUPDSMYJEAA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |