C10H23NO — CID 62601315
1-methoxy-N,6-dimethylheptan-4-amine (PubChem CID 62601315) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is 1-methoxy-N,6-dimethylheptan-4-amine.
| Compound Name | 1-methoxy-N,6-dimethylheptan-4-amine |
|---|---|
| PubChem CID | 62601315 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 1-methoxy-N,6-dimethylheptan-4-amine |
| SMILES | CNC(CCCOC)CC(C)C |
| InChI | InChI=1S/C10H23NO/c1-9(2)8-10(11-3)6-5-7-12-4/h9-11H,5-8H2,1-4H3 |
| InChIKey | KMVPGBWXTQYKCV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|