C10H23NO — CID 116719993
3-methoxy-N,2-dimethylheptan-4-amine (PubChem CID 116719993) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is 3-methoxy-N,2-dimethylheptan-4-amine.
| Compound Name | 3-methoxy-N,2-dimethylheptan-4-amine |
|---|---|
| PubChem CID | 116719993 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 3-methoxy-N,2-dimethylheptan-4-amine |
| SMILES | CCCC(NC)C(OC)C(C)C |
| InChI | InChI=1S/C10H23NO/c1-6-7-9(11-4)10(12-5)8(2)3/h8-11H,6-7H2,1-5H3 |
| InChIKey | XEUTVFPBVAEZQQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |