C11H26N2O — CID 105271928
(3-methoxy-2,7-dimethyloctan-4-yl)hydrazine (PubChem CID 105271928) has the molecular formula C11H26N2O and a molecular weight of 202.34 g/mol. Its IUPAC name is (3-methoxy-2,7-dimethyloctan-4-yl)hydrazine.
| Compound Name | (3-methoxy-2,7-dimethyloctan-4-yl)hydrazine |
|---|---|
| PubChem CID | 105271928 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | (3-methoxy-2,7-dimethyloctan-4-yl)hydrazine |
| SMILES | COC(C(C)C)C(CCC(C)C)NN |
| InChI | InChI=1S/C11H26N2O/c1-8(2)6-7-10(13-12)11(14-5)9(3)4/h8-11,13H,6-7,12H2,1-5H3 |
| InChIKey | CTGAMXHAURSHKJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|