C12H24N4O — CID 105272137
[1-(2,5-dimethylpyrazol-3-yl)-3-methoxy-4-methylpentan-2-yl]hydrazine (PubChem CID 105272137) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is [1-(2,5-dimethylpyrazol-3-yl)-3-methoxy-4-methylpentan-2-yl]hydrazine.
| Compound Name | [1-(2,5-dimethylpyrazol-3-yl)-3-methoxy-4-methylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105272137 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | [1-(2,5-dimethylpyrazol-3-yl)-3-methoxy-4-methylpentan-2-yl]hydrazine |
| SMILES | COC(C(C)C)C(Cc1cc(C)nn1C)NN |
| InChI | InChI=1S/C12H24N4O/c1-8(2)12(17-5)11(14-13)7-10-6-9(3)15-16(10)4/h6,8,11-12,14H,7,13H2,1-5H3 |
| InChIKey | RJGAUWIKXKGPEP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|